C24H36O4Si — CID 134833844
methyl (2Z,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-phenylundeca-2,7-dienoate (PubChem CID 134833844) has the molecular formula C24H36O4Si and a molecular weight of 416.63 g/mol. Its IUPAC name is methyl (2Z,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-phenylundeca-2,7-dienoate.
| Compound Name | methyl (2Z,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-phenylundeca-2,7-dienoate |
|---|---|
| PubChem CID | 134833844 |
| Molecular Formula | C24H36O4Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | methyl (2Z,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-9-oxo-11-phenylundeca-2,7-dienoate |
| SMILES | COC(=O)/C=C\C[C@@H](C/C=C/C(=O)CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H36O4Si/c1-24(2,3)29(5,6)28-22(16-11-17-23(26)27-4)15-10-14-21(25)19-18-20-12-8-7-9-13-20/h7-14,17,22H,15-16,18-19H2,1-6H3/b14-10+,17-11-/t22-/m1/s1 |
| InChIKey | AWESTMHLIJGMOA-KRQAISLNSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|