C23H32O — CID 91159824
(E)-1,7-diphenylhept-4-en-3-one;ethane (PubChem CID 91159824) has the molecular formula C23H32O and a molecular weight of 324.51 g/mol. Its IUPAC name is (E)-1,7-diphenylhept-4-en-3-one;ethane.
| Compound Name | (E)-1,7-diphenylhept-4-en-3-one;ethane |
|---|---|
| PubChem CID | 91159824 |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (E)-1,7-diphenylhept-4-en-3-one;ethane |
| SMILES | CC.CC.O=C(/C=C/CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H20O.2C2H6/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17;2*1-2/h1-6,8-12,14H,7,13,15-16H2;2*1-2H3/b14-8+;; |
| InChIKey | VKXOAYKCVQPOAR-JPMXUBAOSA-N |
| XLogP | 6.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|