C26H28O4 — CID 11211860
dimethyl (Z)-2,3-bis[(E)-4-phenylbut-1-enyl]but-2-enedioate (PubChem CID 11211860) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is dimethyl (Z)-2,3-bis[(E)-4-phenylbut-1-enyl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2,3-bis[(E)-4-phenylbut-1-enyl]but-2-enedioate |
|---|---|
| PubChem CID | 11211860 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | dimethyl (Z)-2,3-bis[(E)-4-phenylbut-1-enyl]but-2-enedioate |
| SMILES | COC(=O)C(/C=C/CCc1ccccc1)=C(/C=C/CCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C26H28O4/c1-29-25(27)23(19-11-9-17-21-13-5-3-6-14-21)24(26(28)30-2)20-12-10-18-22-15-7-4-8-16-22/h3-8,11-16,19-20H,9-10,17-18H2,1-2H3/b19-11+,20-12+,24-23- |
| InChIKey | WWWNZDQJAXGSKD-KDYNUOSPSA-N |
| XLogP | 5.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|