C26H36O4 — CID 132537121
ditert-butyl (Z)-2-[(4E)-2-methyl-7-phenylhepta-2,4-dien-3-yl]but-2-enedioate (PubChem CID 132537121) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is ditert-butyl (Z)-2-[(4E)-2-methyl-7-phenylhepta-2,4-dien-3-yl]but-2-enedioate.
| Compound Name | ditert-butyl (Z)-2-[(4E)-2-methyl-7-phenylhepta-2,4-dien-3-yl]but-2-enedioate |
|---|---|
| PubChem CID | 132537121 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | ditert-butyl (Z)-2-[(4E)-2-methyl-7-phenylhepta-2,4-dien-3-yl]but-2-enedioate |
| SMILES | CC(C)=C(/C=C/CCc1ccccc1)/C(=C/C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H36O4/c1-19(2)21(17-13-12-16-20-14-10-9-11-15-20)22(24(28)30-26(6,7)8)18-23(27)29-25(3,4)5/h9-11,13-15,17-18H,12,16H2,1-8H3/b17-13+,22-18- |
| InChIKey | HIYGRXPZINEGEB-JOKCNHQFSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|