C18H26O3 — CID 102465462
tert-butyl (E,4R,5S)-5-hydroxy-4-methyl-7-phenylhept-2-enoate (PubChem CID 102465462) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is tert-butyl (E,4R,5S)-5-hydroxy-4-methyl-7-phenylhept-2-enoate.
| Compound Name | tert-butyl (E,4R,5S)-5-hydroxy-4-methyl-7-phenylhept-2-enoate |
|---|---|
| PubChem CID | 102465462 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | tert-butyl (E,4R,5S)-5-hydroxy-4-methyl-7-phenylhept-2-enoate |
| SMILES | C[C@H](/C=C/C(=O)OC(C)(C)C)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C18H26O3/c1-14(10-13-17(20)21-18(2,3)4)16(19)12-11-15-8-6-5-7-9-15/h5-10,13-14,16,19H,11-12H2,1-4H3/b13-10+/t14-,16+/m1/s1 |
| InChIKey | PJYXQJAFATVASD-QCIVWTMKSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|