C19H28O4 — CID 101084653
tert-butyl (E)-3-[(1S,3S)-3-hydroxy-4-methyl-1-phenylpentoxy]prop-2-enoate (PubChem CID 101084653) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl (E)-3-[(1S,3S)-3-hydroxy-4-methyl-1-phenylpentoxy]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[(1S,3S)-3-hydroxy-4-methyl-1-phenylpentoxy]prop-2-enoate |
|---|---|
| PubChem CID | 101084653 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | tert-butyl (E)-3-[(1S,3S)-3-hydroxy-4-methyl-1-phenylpentoxy]prop-2-enoate |
| SMILES | CC(C)[C@@H](O)C[C@H](O/C=C/C(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H28O4/c1-14(2)16(20)13-17(15-9-7-6-8-10-15)22-12-11-18(21)23-19(3,4)5/h6-12,14,16-17,20H,13H2,1-5H3/b12-11+/t16-,17-/m0/s1 |
| InChIKey | CSIFJBGJXZMMFZ-YFXCHKOLSA-N |
| XLogP | 4.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|