C19H29NO3 — CID 101103473
tert-butyl (E)-4-[benzyl(hydroxy)amino]-6-methylhept-2-enoate (PubChem CID 101103473) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is tert-butyl (E)-4-[benzyl(hydroxy)amino]-6-methylhept-2-enoate.
| Compound Name | tert-butyl (E)-4-[benzyl(hydroxy)amino]-6-methylhept-2-enoate |
|---|---|
| PubChem CID | 101103473 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | tert-butyl (E)-4-[benzyl(hydroxy)amino]-6-methylhept-2-enoate |
| SMILES | CC(C)CC(/C=C/C(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C19H29NO3/c1-15(2)13-17(11-12-18(21)23-19(3,4)5)20(22)14-16-9-7-6-8-10-16/h6-12,15,17,22H,13-14H2,1-5H3/b12-11+ |
| InChIKey | NMVSJBOHZYVUMM-VAWYXSNFSA-N |
| XLogP | 4.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|