C15H20O4 — CID 11369081
tert-butyl [(Z,4R)-4-hydroxy-4-phenylbut-2-enyl] carbonate (PubChem CID 11369081) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is tert-butyl [(Z,4R)-4-hydroxy-4-phenylbut-2-enyl] carbonate.
| Compound Name | tert-butyl [(Z,4R)-4-hydroxy-4-phenylbut-2-enyl] carbonate |
|---|---|
| PubChem CID | 11369081 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | tert-butyl [(Z,4R)-4-hydroxy-4-phenylbut-2-enyl] carbonate |
| SMILES | CC(C)(C)OC(=O)OC/C=C\[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H20O4/c1-15(2,3)19-14(17)18-11-7-10-13(16)12-8-5-4-6-9-12/h4-10,13,16H,11H2,1-3H3/b10-7-/t13-/m1/s1 |
| InChIKey | KSISVZJKPMEXSQ-PGJNLMOESA-N |
| XLogP | 3.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|