About tert-butyl [(E)-4-methylpent-2-enyl] carbonate
tert-butyl [(E)-4-methylpent-2-enyl] carbonate (PubChem CID 101385228) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is tert-butyl [(E)-4-methylpent-2-enyl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(E)-4-methylpent-2-enyl] carbonate |
| PubChem CID | 101385228 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | tert-butyl [(E)-4-methylpent-2-enyl] carbonate |
| SMILES | CC(C)/C=C/COC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20O3/c1-9(2)7-6-8-13-10(12)14-11(3,4)5/h6-7,9H,8H2,1-5H3/b7-6+ |
| InChIKey | FIELPYJFDIPGQY-VOTSOKGWSA-N |
| XLogP | 3.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(E)-4-methylpent-2-enyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(E)-4-methylpent-2-enyl] carbonate?
The IUPAC name of tert-butyl [(E)-4-methylpent-2-enyl] carbonate (CID 101385228) is tert-butyl [(E)-4-methylpent-2-enyl] carbonate.
What is the SMILES notation for tert-butyl [(E)-4-methylpent-2-enyl] carbonate?
The canonical SMILES for tert-butyl [(E)-4-methylpent-2-enyl] carbonate is CC(C)/C=C/COC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl [(E)-4-methylpent-2-enyl] carbonate?
The InChIKey is FIELPYJFDIPGQY-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H20O3/c1-9(2)7-6-8-13-10(12)14-11(3,4)5/h6-7,9H,8H2,1-5H3/b7-6+.
What are the key properties of tert-butyl [(E)-4-methylpent-2-enyl] carbonate?
tert-butyl [(E)-4-methylpent-2-enyl] carbonate has a molecular weight of 200.28 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(E)-4-methylpent-2-enyl] carbonate is sourced from PubChem (CID 101385228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).