About (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate
(2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate (PubChem CID 54386102) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate |
| PubChem CID | 54386102 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate |
| SMILES | C[C@H](N)C(=O)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C8H15NO4/c1-5(9)6(10)12-7(11)13-8(2,3)4/h5H,9H2,1-4H3/t5-/m0/s1 |
| InChIKey | VDJAWBLBNREJGP-YFKPBYRVSA-N |
| XLogP | 0.81 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate?
The IUPAC name of (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate (CID 54386102) is (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate.
What is the SMILES notation for (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate?
The canonical SMILES for (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate is C[C@H](N)C(=O)OC(=O)OC(C)(C)C.
What is the InChIKey of (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate?
The InChIKey is VDJAWBLBNREJGP-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H15NO4/c1-5(9)6(10)12-7(11)13-8(2,3)4/h5H,9H2,1-4H3/t5-/m0/s1.
What are the key properties of (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate?
(2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate has a molecular weight of 189.21 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxycarbonyl (2S)-2-aminopropanoate is sourced from PubChem (CID 54386102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).