C13H25NO7 — CID 91150846
(2S)-2-aminopropanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (PubChem CID 91150846) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate.
| Compound Name | (2S)-2-aminopropanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
|---|---|
| PubChem CID | 91150846 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (2S)-2-aminopropanoic acid;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H18O5.C3H7NO2/c1-9(2,3)14-7(11)13-8(12)15-10(4,5)6;1-2(4)3(5)6/h1-6H3;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | NJUXFKAOCPRUSM-WNQIDUERSA-N |
| XLogP | 2.29 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|