C9H17NO4 — CID 174535186
(2-methylpropan-2-yl)oxycarbonyl 3-amino-2-methylpropanoate (PubChem CID 174535186) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 3-amino-2-methylpropanoate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 3-amino-2-methylpropanoate |
|---|---|
| PubChem CID | 174535186 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 3-amino-2-methylpropanoate |
| SMILES | CC(CN)C(=O)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H17NO4/c1-6(5-10)7(11)13-8(12)14-9(2,3)4/h6H,5,10H2,1-4H3 |
| InChIKey | UFTAXDUSWOMWEV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|