C10H15NO4 — CID 56982899
(2-methylpropan-2-yl)oxycarbonyl 2-aminopent-4-ynoate (PubChem CID 56982899) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxycarbonyl 2-aminopent-4-ynoate.
| Compound Name | (2-methylpropan-2-yl)oxycarbonyl 2-aminopent-4-ynoate |
|---|---|
| PubChem CID | 56982899 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (2-methylpropan-2-yl)oxycarbonyl 2-aminopent-4-ynoate |
| SMILES | C#CCC(N)C(=O)OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H15NO4/c1-5-6-7(11)8(12)14-9(13)15-10(2,3)4/h1,7H,6,11H2,2-4H3 |
| InChIKey | ONJABZCMJLAKAS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|