About 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate
1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate (PubChem CID 122423644) has the molecular formula C14H25NO6
and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate |
| PubChem CID | 122423644 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate |
| SMILES | CC(C)(C)OC(=O)OC(=O)CC[C@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO6/c1-13(2,3)20-11(17)9(15)7-8-10(16)19-12(18)21-14(4,5)6/h9H,7-8,15H2,1-6H3/t9-/m0/s1 |
| InChIKey | MSHLLKSTDPRFHF-VIFPVBQESA-N |
| XLogP | 1.91 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate?
The IUPAC name of 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate (CID 122423644) is 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate is CC(C)(C)OC(=O)OC(=O)CC[C@H](N)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate?
The InChIKey is MSHLLKSTDPRFHF-VIFPVBQESA-N. The full InChI is InChI=1S/C14H25NO6/c1-13(2,3)20-11(17)9(15)7-8-10(16)19-12(18)21-14(4,5)6/h9H,7-8,15H2,1-6H3/t9-/m0/s1.
What are the key properties of 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate?
1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate has a molecular weight of 303.36 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-[(2-methylpropan-2-yl)oxycarbonyl] (2S)-2-aminopentanedioate is sourced from PubChem (CID 122423644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).