C9H18N2O3S — CID 91125306
tert-butyl 2-amino-5-oxo-5-(sulfanylamino)pentanoate (PubChem CID 91125306) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is tert-butyl 2-amino-5-oxo-5-(sulfanylamino)pentanoate.
| Compound Name | tert-butyl 2-amino-5-oxo-5-(sulfanylamino)pentanoate |
|---|---|
| PubChem CID | 91125306 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | tert-butyl 2-amino-5-oxo-5-(sulfanylamino)pentanoate |
| SMILES | CC(C)(C)OC(=O)C(N)CCC(=O)NS |
| InChI | InChI=1S/C9H18N2O3S/c1-9(2,3)14-8(13)6(10)4-5-7(12)11-15/h6,15H,4-5,10H2,1-3H3,(H,11,12) |
| InChIKey | BJIZLZBHUYYVGC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|