C9H16NO4- — CID 21119691
(4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoate (PubChem CID 21119691) has the molecular formula C9H16NO4- and a molecular weight of 202.23 g/mol. Its IUPAC name is (4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoate.
| Compound Name | (4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoate |
|---|---|
| PubChem CID | 21119691 |
| Molecular Formula | C9H16NO4- |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (4S)-4-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)CCC(=O)[O-] |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)14-8(13)6(10)4-5-7(11)12/h6H,4-5,10H2,1-3H3,(H,11,12)/p-1/t6-/m0/s1 |
| InChIKey | QVAQMUAKTNUNLN-LURJTMIESA-M |
| XLogP | -0.81 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |