C16H31N3O5 — CID 59784079
tert-butyl 2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate (PubChem CID 59784079) has the molecular formula C16H31N3O5 and a molecular weight of 345.44 g/mol. Its IUPAC name is tert-butyl 2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate.
| Compound Name | tert-butyl 2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 59784079 |
| Molecular Formula | C16H31N3O5 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl 2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)CCC(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N3O5/c1-15(2,3)23-13(21)11(17)7-8-12(20)18-9-10-19-14(22)24-16(4,5)6/h11H,7-10,17H2,1-6H3,(H,18,20)(H,19,22) |
| InChIKey | LXJPCBMDEAVASB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|