C15H27N3O5 — CID 87111804
prop-1-en-2-yl (2S)-2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate (PubChem CID 87111804) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is prop-1-en-2-yl (2S)-2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate.
| Compound Name | prop-1-en-2-yl (2S)-2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 87111804 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | prop-1-en-2-yl (2S)-2-amino-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]-5-oxopentanoate |
| SMILES | C=C(C)OC(=O)[C@@H](N)CCC(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O5/c1-10(2)22-13(20)11(16)6-7-12(19)17-8-9-18-14(21)23-15(3,4)5/h11H,1,6-9,16H2,2-5H3,(H,17,19)(H,18,21)/t11-/m0/s1 |
| InChIKey | WCFNKUDNYQZDQK-NSHDSACASA-N |
| XLogP | 0.81 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|