About bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate
bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate (PubChem CID 87686493) has the molecular formula C17H29NO8
and a molecular weight of 375.42 g/mol. Its IUPAC name is bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate.
Molecular Properties
| Compound Name | bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate |
| PubChem CID | 87686493 |
| Molecular Formula | C17H29NO8 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate |
| SMILES | CC(C)(C)OC(=O)COC(=O)CCC(N)C(=O)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO8/c1-16(2,3)25-13(20)9-23-12(19)8-7-11(18)15(22)24-10-14(21)26-17(4,5)6/h11H,7-10,18H2,1-6H3 |
| InChIKey | NYNVUBRJMGYCGH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate?
The IUPAC name of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate (CID 87686493) is bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate.
What is the SMILES notation for bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate?
The canonical SMILES for bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate is CC(C)(C)OC(=O)COC(=O)CCC(N)C(=O)OCC(=O)OC(C)(C)C.
What is the InChIKey of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate?
The InChIKey is NYNVUBRJMGYCGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO8/c1-16(2,3)25-13(20)9-23-12(19)8-7-11(18)15(22)24-10-14(21)26-17(4,5)6/h11H,7-10,18H2,1-6H3.
What are the key properties of bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate?
bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate has a molecular weight of 375.42 g/mol, XLogP of 0.86, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 2-aminopentanedioate is sourced from PubChem (CID 87686493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).