C16H30N2O8 — CID 91573357
diethyl 2-aminopentanedioate;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 91573357) has the molecular formula C16H30N2O8 and a molecular weight of 378.42 g/mol. Its IUPAC name is diethyl 2-aminopentanedioate;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | diethyl 2-aminopentanedioate;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 91573357 |
| Molecular Formula | C16H30N2O8 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | diethyl 2-aminopentanedioate;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCC(=O)O.CCOC(=O)CCC(N)C(=O)OCC |
| InChI | InChI=1S/C9H17NO4.C7H13NO4/c1-3-13-8(11)6-5-7(10)9(12)14-4-2;1-7(2,3)12-6(11)8-4-5(9)10/h7H,3-6,10H2,1-2H3;4H2,1-3H3,(H,8,11)(H,9,10) |
| InChIKey | JIBITIAQKHLAQG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|