C12H21NO5 — CID 130277620
ethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate (PubChem CID 130277620) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is ethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate.
| Compound Name | ethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
|---|---|
| PubChem CID | 130277620 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | ethyl 5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO5/c1-5-17-10(15)7-6-9(14)8-13-11(16)18-12(2,3)4/h5-8H2,1-4H3,(H,13,16) |
| InChIKey | XIORSGLSWXITHT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |