C10H22ClNO2 — CID 56776989
tert-butyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride (PubChem CID 56776989) has the molecular formula C10H22ClNO2 and a molecular weight of 223.74 g/mol. Its IUPAC name is tert-butyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride.
| Compound Name | tert-butyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 56776989 |
| Molecular Formula | C10H22ClNO2 |
| Molecular Weight | 223.74 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | tert-butyl (2S)-2-amino-3,3-dimethylbutanoate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)[C@@H](N)C(C)(C)C.Cl |
| InChI | InChI=1S/C10H21NO2.ClH/c1-9(2,3)7(11)8(12)13-10(4,5)6;/h7H,11H2,1-6H3;1H/t7-;/m1./s1 |
| InChIKey | OOJKHARXMDMOCG-OGFXRTJISA-N |
| XLogP | 2.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |