About azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate
azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate (PubChem CID 126720947) has the molecular formula C11H21NO6
and a molecular weight of 263.29 g/mol. Its IUPAC name is azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate.
Molecular Properties
| Compound Name | azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate |
| PubChem CID | 126720947 |
| Molecular Formula | C11H21NO6 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate |
| SMILES | CCC(OC(C)=O)C(=O)OC(=O)OC(C)(C)C.N |
| InChI | InChI=1S/C11H18O6.H3N/c1-6-8(15-7(2)12)9(13)16-10(14)17-11(3,4)5;/h8H,6H2,1-5H3;1H3 |
| InChIKey | DVPAXKHMGFZKJU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate?
The IUPAC name of azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate (CID 126720947) is azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate.
What is the SMILES notation for azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate?
The canonical SMILES for azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate is CCC(OC(C)=O)C(=O)OC(=O)OC(C)(C)C.N.
What is the InChIKey of azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate?
The InChIKey is DVPAXKHMGFZKJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6.H3N/c1-6-8(15-7(2)12)9(13)16-10(14)17-11(3,4)5;/h8H,6H2,1-5H3;1H3.
What are the key properties of azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate?
azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate has a molecular weight of 263.29 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2-methylpropan-2-yl)oxycarbonyl 2-acetyloxybutanoate is sourced from PubChem (CID 126720947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).