C13H23NO2 — CID 135038852
tert-butyl N-[(2E)-6-methylhepta-2,4-dienyl]carbamate (PubChem CID 135038852) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is tert-butyl N-[(2E)-6-methylhepta-2,4-dienyl]carbamate.
| Compound Name | tert-butyl N-[(2E)-6-methylhepta-2,4-dienyl]carbamate |
|---|---|
| PubChem CID | 135038852 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | tert-butyl N-[(2E)-6-methylhepta-2,4-dienyl]carbamate |
| SMILES | CC(C)C=C/C=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO2/c1-11(2)9-7-6-8-10-14-12(15)16-13(3,4)5/h6-9,11H,10H2,1-5H3,(H,14,15)/b8-6+,9-7? |
| InChIKey | YUUAWLCFDZLYDH-SLNLOJKFSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|