C14H25NO4 — CID 10333402
[(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] acetate (PubChem CID 10333402) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is [(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] acetate.
| Compound Name | [(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] acetate |
|---|---|
| PubChem CID | 10333402 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | [(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H25NO4/c1-10(2)12(8-7-9-18-11(3)16)15-13(17)19-14(4,5)6/h7-8,10,12H,9H2,1-6H3,(H,15,17)/b8-7+/t12-/m1/s1 |
| InChIKey | HKJZKFSSDRSBOS-ABZNLYFFSA-N |
| XLogP | 2.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|