C19H27NO4 — CID 10088199
[(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] benzoate (PubChem CID 10088199) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is [(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] benzoate.
| Compound Name | [(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] benzoate |
|---|---|
| PubChem CID | 10088199 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [(E,4S)-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enyl] benzoate |
| SMILES | CC(C)[C@@H](/C=C/COC(=O)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO4/c1-14(2)16(20-18(22)24-19(3,4)5)12-9-13-23-17(21)15-10-7-6-8-11-15/h6-12,14,16H,13H2,1-5H3,(H,20,22)/b12-9+/t16-/m1/s1 |
| InChIKey | SQDPFCYBUDHVIP-ONOODXEBSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|