C17H27NO6 — CID 101209885
ethyl (E)-7-acetyloxy-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate (PubChem CID 101209885) has the molecular formula C17H27NO6 and a molecular weight of 341.40 g/mol. Its IUPAC name is ethyl (E)-7-acetyloxy-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate.
| Compound Name | ethyl (E)-7-acetyloxy-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate |
|---|---|
| PubChem CID | 101209885 |
| Molecular Formula | C17H27NO6 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | ethyl (E)-7-acetyloxy-4-methylidene-2-[(2-methylpropan-2-yl)oxycarbonylamino]hept-5-enoate |
| SMILES | C=C(/C=C/COC(C)=O)CC(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C17H27NO6/c1-7-22-15(20)14(18-16(21)24-17(4,5)6)11-12(2)9-8-10-23-13(3)19/h8-9,14H,2,7,10-11H2,1,3-6H3,(H,18,21)/b9-8+ |
| InChIKey | YIEATPUEFZAJDR-CMDGGOBGSA-N |
| XLogP | 2.51 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|