C16H29NO3 — CID 10062387
tert-butyl N-[(E,3S)-2,6-dimethyl-8-oxonon-4-en-3-yl]carbamate (PubChem CID 10062387) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl N-[(E,3S)-2,6-dimethyl-8-oxonon-4-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(E,3S)-2,6-dimethyl-8-oxonon-4-en-3-yl]carbamate |
|---|---|
| PubChem CID | 10062387 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl N-[(E,3S)-2,6-dimethyl-8-oxonon-4-en-3-yl]carbamate |
| SMILES | CC(=O)CC(C)/C=C/[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H29NO3/c1-11(2)14(9-8-12(3)10-13(4)18)17-15(19)20-16(5,6)7/h8-9,11-12,14H,10H2,1-7H3,(H,17,19)/b9-8+/t12?,14-/m1/s1 |
| InChIKey | ANQPQFYZJYEZHO-IMMVMANDSA-N |
| XLogP | 3.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|