C9H16FNO3 — CID 130003566
tert-butyl N-[(E)-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate (PubChem CID 130003566) has the molecular formula C9H16FNO3 and a molecular weight of 205.23 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 130003566 |
| Molecular Formula | C9H16FNO3 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | tert-butyl N-[(E)-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(/C=C/F)CO |
| InChI | InChI=1S/C9H16FNO3/c1-9(2,3)14-8(13)11-7(6-12)4-5-10/h4-5,7,12H,6H2,1-3H3,(H,11,13)/b5-4+ |
| InChIKey | AHUSIVAEVXNVIF-SNAWJCMRSA-N |
| XLogP | 1.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |