C13H25FNO6P — CID 58906699
tert-butyl N-[(E,2S)-4-diethoxyphosphoryl-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate (PubChem CID 58906699) has the molecular formula C13H25FNO6P and a molecular weight of 341.32 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-4-diethoxyphosphoryl-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-4-diethoxyphosphoryl-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58906699 |
| Molecular Formula | C13H25FNO6P |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl N-[(E,2S)-4-diethoxyphosphoryl-4-fluoro-1-hydroxybut-3-en-2-yl]carbamate |
| SMILES | CCOP(=O)(OCC)/C(F)=C/[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25FNO6P/c1-6-19-22(18,20-7-2)11(14)8-10(9-16)15-12(17)21-13(3,4)5/h8,10,16H,6-7,9H2,1-5H3,(H,15,17)/b11-8+/t10-/m0/s1 |
| InChIKey | PKOWJQWVGZUVKE-NGPGYTDTSA-N |
| XLogP | 2.95 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|