C13H23FNO7P — CID 58906679
(E,2R)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid (PubChem CID 58906679) has the molecular formula C13H23FNO7P and a molecular weight of 355.30 g/mol. Its IUPAC name is (E,2R)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid.
| Compound Name | (E,2R)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
|---|---|
| PubChem CID | 58906679 |
| Molecular Formula | C13H23FNO7P |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (E,2R)-4-diethoxyphosphoryl-4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]but-3-enoic acid |
| SMILES | CCOP(=O)(OCC)/C(F)=C/[C@@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H23FNO7P/c1-6-20-23(19,21-7-2)10(14)8-9(11(16)17)15-12(18)22-13(3,4)5/h8-9H,6-7H2,1-5H3,(H,15,18)(H,16,17)/b10-8+/t9-/m1/s1 |
| InChIKey | OXUZIOREBCJAHP-NCXKZPMSSA-N |
| XLogP | 3.04 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|