C13H23FNO6P — CID 89127115
tert-butyl N-[(E,2R)-4-diethoxyphosphoryl-4-fluoro-1-oxobut-3-en-2-yl]carbamate (PubChem CID 89127115) has the molecular formula C13H23FNO6P and a molecular weight of 339.30 g/mol. Its IUPAC name is tert-butyl N-[(E,2R)-4-diethoxyphosphoryl-4-fluoro-1-oxobut-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2R)-4-diethoxyphosphoryl-4-fluoro-1-oxobut-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 89127115 |
| Molecular Formula | C13H23FNO6P |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | tert-butyl N-[(E,2R)-4-diethoxyphosphoryl-4-fluoro-1-oxobut-3-en-2-yl]carbamate |
| SMILES | CCOP(=O)(OCC)/C(F)=C/[C@H](C=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23FNO6P/c1-6-19-22(18,20-7-2)11(14)8-10(9-16)15-12(17)21-13(3,4)5/h8-10H,6-7H2,1-5H3,(H,15,17)/b11-8+/t10-/m1/s1 |
| InChIKey | GXMDBYUJHPAEKR-MXBGMFSPSA-N |
| XLogP | 3.16 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|