C11H22N2O2 — CID 142556897
tert-butyl N-[1-(methylamino)pent-3-en-2-yl]carbamate (PubChem CID 142556897) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is tert-butyl N-[1-(methylamino)pent-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(methylamino)pent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 142556897 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | tert-butyl N-[1-(methylamino)pent-3-en-2-yl]carbamate |
| SMILES | CC=CC(CNC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-6-7-9(8-12-5)13-10(14)15-11(2,3)4/h6-7,9,12H,8H2,1-5H3,(H,13,14) |
| InChIKey | WWPFNSQSVCPQDY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|