C10H17NO4 — CID 10443257
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (PubChem CID 10443257) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid.
| Compound Name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
|---|---|
| PubChem CID | 10443257 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| SMILES | C=C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO4/c1-5-7(6-8(12)13)11-9(14)15-10(2,3)4/h5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13)/t7-/m1/s1 |
| InChIKey | AQTGANYMYTZCKP-SSDOTTSWSA-N |
| XLogP | 1.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|