C15H19F2NO2 — CID 20726934
tert-butyl N-[1-(3,5-difluorophenyl)but-3-en-2-yl]carbamate (PubChem CID 20726934) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl N-[1-(3,5-difluorophenyl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3,5-difluorophenyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 20726934 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl N-[1-(3,5-difluorophenyl)but-3-en-2-yl]carbamate |
| SMILES | C=CC(Cc1cc(F)cc(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19F2NO2/c1-5-13(18-14(19)20-15(2,3)4)8-10-6-11(16)9-12(17)7-10/h5-7,9,13H,1,8H2,2-4H3,(H,18,19) |
| InChIKey | AMDGIZHEUOQZBG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|