C15H19F2NO2 — CID 118054561
tert-butyl N-[(1R)-1-[3-fluoro-5-(fluoromethyl)phenyl]prop-2-enyl]carbamate (PubChem CID 118054561) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[3-fluoro-5-(fluoromethyl)phenyl]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[3-fluoro-5-(fluoromethyl)phenyl]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 118054561 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | tert-butyl N-[(1R)-1-[3-fluoro-5-(fluoromethyl)phenyl]prop-2-enyl]carbamate |
| SMILES | C=C[C@@H](NC(=O)OC(C)(C)C)c1cc(F)cc(CF)c1 |
| InChI | InChI=1S/C15H19F2NO2/c1-5-13(18-14(19)20-15(2,3)4)11-6-10(9-16)7-12(17)8-11/h5-8,13H,1,9H2,2-4H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | RWIKCEFZSCZPJS-CYBMUJFWSA-N |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|