C14H17FN2O2 — CID 86651093
tert-butyl N-[1-(3-cyano-5-fluorophenyl)ethyl]carbamate (PubChem CID 86651093) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is tert-butyl N-[1-(3-cyano-5-fluorophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(3-cyano-5-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 86651093 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | tert-butyl N-[1-(3-cyano-5-fluorophenyl)ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C14H17FN2O2/c1-9(17-13(18)19-14(2,3)4)11-5-10(8-16)6-12(15)7-11/h5-7,9H,1-4H3,(H,17,18) |
| InChIKey | ODFVRCXRUHYRKG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |