C14H16FNO3 — CID 123308600
tert-butyl 3-(3-cyano-5-fluorophenyl)-3-hydroxypropanoate (PubChem CID 123308600) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is tert-butyl 3-(3-cyano-5-fluorophenyl)-3-hydroxypropanoate.
| Compound Name | tert-butyl 3-(3-cyano-5-fluorophenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 123308600 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | tert-butyl 3-(3-cyano-5-fluorophenyl)-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)CC(O)c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C14H16FNO3/c1-14(2,3)19-13(18)7-12(17)10-4-9(8-16)5-11(15)6-10/h4-6,12,17H,7H2,1-3H3 |
| InChIKey | VXXAOSUZAHPRMZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |