C16H21FN2O2 — CID 66652557
tert-butyl 2-[(3-cyano-5-fluorophenyl)methylamino]-2-methylpropanoate (PubChem CID 66652557) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is tert-butyl 2-[(3-cyano-5-fluorophenyl)methylamino]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[(3-cyano-5-fluorophenyl)methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 66652557 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | tert-butyl 2-[(3-cyano-5-fluorophenyl)methylamino]-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)NCc1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C16H21FN2O2/c1-15(2,3)21-14(20)16(4,5)19-10-12-6-11(9-18)7-13(17)8-12/h6-8,19H,10H2,1-5H3 |
| InChIKey | DRUGLDXGMFFYMK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |