C10H17NO3 — CID 87517564
tert-butyl N-(5-oxopent-1-en-3-yl)carbamate (PubChem CID 87517564) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is tert-butyl N-(5-oxopent-1-en-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-oxopent-1-en-3-yl)carbamate |
|---|---|
| PubChem CID | 87517564 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | tert-butyl N-(5-oxopent-1-en-3-yl)carbamate |
| SMILES | C=CC(CC=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17NO3/c1-5-8(6-7-12)11-9(13)14-10(2,3)4/h5,7-8H,1,6H2,2-4H3,(H,11,13) |
| InChIKey | JMUPFNSOKZVKTF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|