C11H21NO2S — CID 90058718
tert-butyl N-(5-methylsulfanylpent-1-en-3-yl)carbamate (PubChem CID 90058718) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is tert-butyl N-(5-methylsulfanylpent-1-en-3-yl)carbamate.
| Compound Name | tert-butyl N-(5-methylsulfanylpent-1-en-3-yl)carbamate |
|---|---|
| PubChem CID | 90058718 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | tert-butyl N-(5-methylsulfanylpent-1-en-3-yl)carbamate |
| SMILES | C=CC(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO2S/c1-6-9(7-8-15-5)12-10(13)14-11(2,3)4/h6,9H,1,7-8H2,2-5H3,(H,12,13) |
| InChIKey | UWKZNCWTDCYPKJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|