C14H25NO4S — CID 11748703
2-methylprop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate (PubChem CID 11748703) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is 2-methylprop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate.
| Compound Name | 2-methylprop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 11748703 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-methylprop-2-enyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoate |
| SMILES | C=C(C)COC(=O)C(CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4S/c1-10(2)9-18-12(16)11(7-8-20-6)15-13(17)19-14(3,4)5/h11H,1,7-9H2,2-6H3,(H,15,17) |
| InChIKey | BSESJRNRXFJFDL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|