C11H20N2O3S — CID 130004276
tert-butyl N-(1-cyano-1-hydroxy-4-methylsulfanylbutan-2-yl)carbamate (PubChem CID 130004276) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is tert-butyl N-(1-cyano-1-hydroxy-4-methylsulfanylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-cyano-1-hydroxy-4-methylsulfanylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 130004276 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | tert-butyl N-(1-cyano-1-hydroxy-4-methylsulfanylbutan-2-yl)carbamate |
| SMILES | CSCCC(NC(=O)OC(C)(C)C)C(O)C#N |
| InChI | InChI=1S/C11H20N2O3S/c1-11(2,3)16-10(15)13-8(5-6-17-4)9(14)7-12/h8-9,14H,5-6H2,1-4H3,(H,13,15) |
| InChIKey | JVXWZICBUJOMOC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|