C18H33NO6S — CID 122222240
diethyl 2-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentan-2-yl]propanedioate (PubChem CID 122222240) has the molecular formula C18H33NO6S and a molecular weight of 391.53 g/mol. Its IUPAC name is diethyl 2-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentan-2-yl]propanedioate.
| Compound Name | diethyl 2-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentan-2-yl]propanedioate |
|---|---|
| PubChem CID | 122222240 |
| Molecular Formula | C18H33NO6S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | diethyl 2-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfanylpentan-2-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](C)[C@H](CCSC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO6S/c1-8-23-15(20)14(16(21)24-9-2)12(3)13(10-11-26-7)19-17(22)25-18(4,5)6/h12-14H,8-11H2,1-7H3,(H,19,22)/t12-,13-/m0/s1 |
| InChIKey | NZACEGWJURTPSV-STQMWFEESA-N |
| XLogP | 3.01 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|