C18H31NO8 — CID 135149085
7-ethoxy-6-ethoxycarbonyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptanoic acid (PubChem CID 135149085) has the molecular formula C18H31NO8 and a molecular weight of 389.45 g/mol. Its IUPAC name is 7-ethoxy-6-ethoxycarbonyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptanoic acid.
| Compound Name | 7-ethoxy-6-ethoxycarbonyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 135149085 |
| Molecular Formula | C18H31NO8 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 7-ethoxy-6-ethoxycarbonyl-5-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-7-oxoheptanoic acid |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)C(CCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO8/c1-7-25-15(22)14(16(23)26-8-2)11(3)12(9-10-13(20)21)19-17(24)27-18(4,5)6/h11-12,14H,7-10H2,1-6H3,(H,19,24)(H,20,21) |
| InChIKey | CSRQREMRWPBCQT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|