C10H19N2O5S+ — CID 175364976
[(2S)-1-amino-4-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxosulfanium (PubChem CID 175364976) has the molecular formula C10H19N2O5S+ and a molecular weight of 279.34 g/mol. Its IUPAC name is [(2S)-1-amino-4-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxosulfanium.
| Compound Name | [(2S)-1-amino-4-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxosulfanium |
|---|---|
| PubChem CID | 175364976 |
| Molecular Formula | C10H19N2O5S+ |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [(2S)-1-amino-4-carboxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-oxosulfanium |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(N)[S+]=O |
| InChI | InChI=1S/C10H18N2O5S/c1-10(2,3)17-9(15)12-6(8(11)18-16)4-5-7(13)14/h6,8H,4-5,11H2,1-3H3,(H-,12,13,14,15)/p+1/t6-,8?/m0/s1 |
| InChIKey | WFMIFSQCICOCOD-UUEFVBAFSA-O |
| XLogP | 0.46 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|