C14H27NO5 — CID 170107362
4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]pentanoic acid (PubChem CID 170107362) has the molecular formula C14H27NO5 and a molecular weight of 289.37 g/mol. Its IUPAC name is 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]pentanoic acid.
| Compound Name | 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]pentanoic acid |
|---|---|
| PubChem CID | 170107362 |
| Molecular Formula | C14H27NO5 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]butoxy]pentanoic acid |
| SMILES | CC(CCOC(C)CCC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27NO5/c1-10(15-13(18)20-14(3,4)5)8-9-19-11(2)6-7-12(16)17/h10-11H,6-9H2,1-5H3,(H,15,18)(H,16,17) |
| InChIKey | VYSQWHCWWQGFIQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |