C13H27NO4 — CID 143288950
tert-butyl N-[4-(2-methoxypropan-2-yloxy)butan-2-yl]carbamate (PubChem CID 143288950) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is tert-butyl N-[4-(2-methoxypropan-2-yloxy)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-(2-methoxypropan-2-yloxy)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 143288950 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | tert-butyl N-[4-(2-methoxypropan-2-yloxy)butan-2-yl]carbamate |
| SMILES | COC(C)(C)OCCC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27NO4/c1-10(8-9-17-13(5,6)16-7)14-11(15)18-12(2,3)4/h10H,8-9H2,1-7H3,(H,14,15) |
| InChIKey | DKYWVCISMNEEKB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|