C13H22N3O6P — CID 101367731
tert-butyl N-[(3R)-6-diazo-6-dimethoxyphosphoryl-5-oxohex-1-en-3-yl]carbamate (PubChem CID 101367731) has the molecular formula C13H22N3O6P and a molecular weight of 347.31 g/mol. Its IUPAC name is tert-butyl N-[(3R)-6-diazo-6-dimethoxyphosphoryl-5-oxohex-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-6-diazo-6-dimethoxyphosphoryl-5-oxohex-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 101367731 |
| Molecular Formula | C13H22N3O6P |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl N-[(3R)-6-diazo-6-dimethoxyphosphoryl-5-oxohex-1-en-3-yl]carbamate |
| SMILES | C=C[C@@H](CC(=O)C(=[N+]=[N-])P(=O)(OC)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22N3O6P/c1-7-9(15-12(18)22-13(2,3)4)8-10(17)11(16-14)23(19,20-5)21-6/h7,9H,1,8H2,2-6H3,(H,15,18)/t9-/m0/s1 |
| InChIKey | OFHVZCJMMVVAHU-VIFPVBQESA-N |
| XLogP | 2.14 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|