C10H20FNO3 — CID 172915809
tert-butyl N-[(2R,4S)-4-fluoro-5-hydroxypentan-2-yl]carbamate (PubChem CID 172915809) has the molecular formula C10H20FNO3 and a molecular weight of 221.27 g/mol. Its IUPAC name is tert-butyl N-[(2R,4S)-4-fluoro-5-hydroxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4S)-4-fluoro-5-hydroxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 172915809 |
| Molecular Formula | C10H20FNO3 |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | tert-butyl N-[(2R,4S)-4-fluoro-5-hydroxypentan-2-yl]carbamate |
| SMILES | C[C@H](C[C@H](F)CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20FNO3/c1-7(5-8(11)6-13)12-9(14)15-10(2,3)4/h7-8,13H,5-6H2,1-4H3,(H,12,14)/t7-,8+/m1/s1 |
| InChIKey | ICVVUHQYAKVNPB-SFYZADRCSA-N |
| XLogP | 1.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |